C18H25N3O2S — CID 75361389
2-acetamido-N-[1-(1-adamantyl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 75361389) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-acetamido-N-[1-(1-adamantyl)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-acetamido-N-[1-(1-adamantyl)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 75361389 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 2-acetamido-N-[1-(1-adamantyl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)Nc1nc(C(=O)NC(C)C23CC4CC(CC(C4)C2)C3)cs1 |
| InChI | InChI=1S/C18H25N3O2S/c1-10(18-6-12-3-13(7-18)5-14(4-12)8-18)19-16(23)15-9-24-17(21-15)20-11(2)22/h9-10,12-14H,3-8H2,1-2H3,(H,19,23)(H,20,21,22) |
| InChIKey | SZIBGDCEETXDTG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |