C19H27N3O2S — CID 51117811
N'-[1-(1-adamantyl)ethyl]-N-(1,3-thiazol-2-yl)butanediamide (PubChem CID 51117811) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is N'-[1-(1-adamantyl)ethyl]-N-(1,3-thiazol-2-yl)butanediamide.
| Compound Name | N'-[1-(1-adamantyl)ethyl]-N-(1,3-thiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 51117811 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N'-[1-(1-adamantyl)ethyl]-N-(1,3-thiazol-2-yl)butanediamide |
| SMILES | CC(NC(=O)CCC(=O)Nc1nccs1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H27N3O2S/c1-12(19-9-13-6-14(10-19)8-15(7-13)11-19)21-16(23)2-3-17(24)22-18-20-4-5-25-18/h4-5,12-15H,2-3,6-11H2,1H3,(H,21,23)(H,20,22,24) |
| InChIKey | OIIRESRPUQTMHV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |