C18H16N4O2S — CID 16948187
N-(4-methylphenyl)-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide (PubChem CID 16948187) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is N-(4-methylphenyl)-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-methylphenyl)-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 16948187 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-(4-methylphenyl)-2-(phenylcarbamoylamino)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2csc(NC(=O)Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H16N4O2S/c1-12-7-9-14(10-8-12)19-16(23)15-11-25-18(21-15)22-17(24)20-13-5-3-2-4-6-13/h2-11H,1H3,(H,19,23)(H2,20,21,22,24) |
| InChIKey | ZLEGPDMANQBOIC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |