C16H18ClN3OS — CID 30941985
2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]-1-piperidin-1-ylethanone (PubChem CID 30941985) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is 2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 30941985 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[2-(3-chloroanilino)-1,3-thiazol-4-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(Cc1csc(Nc2cccc(Cl)c2)n1)N1CCCCC1 |
| InChI | InChI=1S/C16H18ClN3OS/c17-12-5-4-6-13(9-12)18-16-19-14(11-22-16)10-15(21)20-7-2-1-3-8-20/h4-6,9,11H,1-3,7-8,10H2,(H,18,19) |
| InChIKey | IXYQCRKFRJEJEG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |