C13H14N2OS — CID 84570012
1-[4-[(4-ethyl-1,3-thiazol-2-yl)amino]phenyl]ethanone (PubChem CID 84570012) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-[4-[(4-ethyl-1,3-thiazol-2-yl)amino]phenyl]ethanone.
| Compound Name | 1-[4-[(4-ethyl-1,3-thiazol-2-yl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 84570012 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-[4-[(4-ethyl-1,3-thiazol-2-yl)amino]phenyl]ethanone |
| SMILES | CCc1csc(Nc2ccc(C(C)=O)cc2)n1 |
| InChI | InChI=1S/C13H14N2OS/c1-3-11-8-17-13(14-11)15-12-6-4-10(5-7-12)9(2)16/h4-8H,3H2,1-2H3,(H,14,15) |
| InChIKey | CAEAQGUVIMHFJW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |