C20H19N3O3S — CID 30940427
ethyl 4-[[2-(2-anilino-1,3-thiazol-4-yl)acetyl]amino]benzoate (PubChem CID 30940427) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is ethyl 4-[[2-(2-anilino-1,3-thiazol-4-yl)acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(2-anilino-1,3-thiazol-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 30940427 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | ethyl 4-[[2-(2-anilino-1,3-thiazol-4-yl)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Cc2csc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C20H19N3O3S/c1-2-26-19(25)14-8-10-16(11-9-14)21-18(24)12-17-13-27-20(23-17)22-15-6-4-3-5-7-15/h3-11,13H,2,12H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | UHOMZRFHOUIYNF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |