C18H21N3O5S — CID 16883796
butyl 4-[[2-[2-(methoxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]benzoate (PubChem CID 16883796) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is butyl 4-[[2-[2-(methoxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[2-(methoxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16883796 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | butyl 4-[[2-[2-(methoxycarbonylamino)-1,3-thiazol-4-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)Cc2csc(NC(=O)OC)n2)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-3-4-9-26-16(23)12-5-7-13(8-6-12)19-15(22)10-14-11-27-17(20-14)21-18(24)25-2/h5-8,11H,3-4,9-10H2,1-2H3,(H,19,22)(H,20,21,24) |
| InChIKey | ZQLAMPGDSMFECW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|