C25H28N2O3S2 — CID 16839746
butyl 4-[[2-[2-[(2,5-dimethylphenyl)methylsulfanyl]-1,3-thiazol-4-yl]acetyl]amino]benzoate (PubChem CID 16839746) has the molecular formula C25H28N2O3S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is butyl 4-[[2-[2-[(2,5-dimethylphenyl)methylsulfanyl]-1,3-thiazol-4-yl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[2-[(2,5-dimethylphenyl)methylsulfanyl]-1,3-thiazol-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16839746 |
| Molecular Formula | C25H28N2O3S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | butyl 4-[[2-[2-[(2,5-dimethylphenyl)methylsulfanyl]-1,3-thiazol-4-yl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)Cc2csc(SCc3cc(C)ccc3C)n2)cc1 |
| InChI | InChI=1S/C25H28N2O3S2/c1-4-5-12-30-24(29)19-8-10-21(11-9-19)26-23(28)14-22-16-32-25(27-22)31-15-20-13-17(2)6-7-18(20)3/h6-11,13,16H,4-5,12,14-15H2,1-3H3,(H,26,28) |
| InChIKey | BBBVSNBQYCIIQB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|