C15H15N3O4S — CID 41227458
methyl 4-[[2-(2-acetamido-1,3-thiazol-4-yl)acetyl]amino]benzoate (PubChem CID 41227458) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is methyl 4-[[2-(2-acetamido-1,3-thiazol-4-yl)acetyl]amino]benzoate.
| Compound Name | methyl 4-[[2-(2-acetamido-1,3-thiazol-4-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 41227458 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | methyl 4-[[2-(2-acetamido-1,3-thiazol-4-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)Cc2csc(NC(C)=O)n2)cc1 |
| InChI | InChI=1S/C15H15N3O4S/c1-9(19)16-15-18-12(8-23-15)7-13(20)17-11-5-3-10(4-6-11)14(21)22-2/h3-6,8H,7H2,1-2H3,(H,17,20)(H,16,18,19) |
| InChIKey | XKFRPXHBQYQESS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |