C9H12N2O2S — CID 123465394
N-[4-(2-oxoethyl)-1,3-thiazol-2-yl]butanamide (PubChem CID 123465394) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is N-[4-(2-oxoethyl)-1,3-thiazol-2-yl]butanamide.
| Compound Name | N-[4-(2-oxoethyl)-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 123465394 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | N-[4-(2-oxoethyl)-1,3-thiazol-2-yl]butanamide |
| SMILES | CCCC(=O)Nc1nc(CC=O)cs1 |
| InChI | InChI=1S/C9H12N2O2S/c1-2-3-8(13)11-9-10-7(4-5-12)6-14-9/h5-6H,2-4H2,1H3,(H,10,11,13) |
| InChIKey | ZBRCJWYAOPREOT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|