C14H24N2OS — CID 55555526
N-(4-propan-2-yl-1,3-thiazol-2-yl)octanamide (PubChem CID 55555526) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is N-(4-propan-2-yl-1,3-thiazol-2-yl)octanamide.
| Compound Name | N-(4-propan-2-yl-1,3-thiazol-2-yl)octanamide |
|---|---|
| PubChem CID | 55555526 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-(4-propan-2-yl-1,3-thiazol-2-yl)octanamide |
| SMILES | CCCCCCCC(=O)Nc1nc(C(C)C)cs1 |
| InChI | InChI=1S/C14H24N2OS/c1-4-5-6-7-8-9-13(17)16-14-15-12(10-18-14)11(2)3/h10-11H,4-9H2,1-3H3,(H,15,16,17) |
| InChIKey | LZKDMDSXQDSPRE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|