C9H14N2OS2 — CID 107025335
N-(4-propan-2-yl-1,3-thiazol-2-yl)-3-sulfanylpropanamide (PubChem CID 107025335) has the molecular formula C9H14N2OS2 and a molecular weight of 230.36 g/mol. Its IUPAC name is N-(4-propan-2-yl-1,3-thiazol-2-yl)-3-sulfanylpropanamide.
| Compound Name | N-(4-propan-2-yl-1,3-thiazol-2-yl)-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 107025335 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | N-(4-propan-2-yl-1,3-thiazol-2-yl)-3-sulfanylpropanamide |
| SMILES | CC(C)c1csc(NC(=O)CCS)n1 |
| InChI | InChI=1S/C9H14N2OS2/c1-6(2)7-5-14-9(10-7)11-8(12)3-4-13/h5-6,13H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | QKVHWSNXSWEXQI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|