C9H14N2O2S — CID 47122981
2-methoxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 47122981) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-methoxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-methoxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 47122981 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-methoxy-N-(4-propan-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | COCC(=O)Nc1nc(C(C)C)cs1 |
| InChI | InChI=1S/C9H14N2O2S/c1-6(2)7-5-14-9(10-7)11-8(12)4-13-3/h5-6H,4H2,1-3H3,(H,10,11,12) |
| InChIKey | LCYBCIRTXPOVHN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |