C10H11ClN4O3S — CID 13212056
2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-(2-oxoazetidin-3-yl)acetamide (PubChem CID 13212056) has the molecular formula C10H11ClN4O3S and a molecular weight of 302.74 g/mol. Its IUPAC name is 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-(2-oxoazetidin-3-yl)acetamide.
| Compound Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-(2-oxoazetidin-3-yl)acetamide |
|---|---|
| PubChem CID | 13212056 |
| Molecular Formula | C10H11ClN4O3S |
| Molecular Weight | 302.74 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-[2-[(2-chloroacetyl)amino]-1,3-thiazol-4-yl]-N-(2-oxoazetidin-3-yl)acetamide |
| SMILES | O=C(CCl)Nc1nc(CC(=O)NC2CNC2=O)cs1 |
| InChI | InChI=1S/C10H11ClN4O3S/c11-2-8(17)15-10-13-5(4-19-10)1-7(16)14-6-3-12-9(6)18/h4,6H,1-3H2,(H,12,18)(H,14,16)(H,13,15,17) |
| InChIKey | ZACUAUXGVKJSOR-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.74 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|