C17H17FN4O3S — CID 73338901
N-[4-[2-(4-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxopiperidine-3-carboxamide (PubChem CID 73338901) has the molecular formula C17H17FN4O3S and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[4-[2-(4-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxopiperidine-3-carboxamide.
| Compound Name | N-[4-[2-(4-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 73338901 |
| Molecular Formula | C17H17FN4O3S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[4-[2-(4-fluoroanilino)-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxopiperidine-3-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)C2CCCNC2=O)n1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN4O3S/c18-10-3-5-11(6-4-10)20-14(23)8-12-9-26-17(21-12)22-16(25)13-2-1-7-19-15(13)24/h3-6,9,13H,1-2,7-8H2,(H,19,24)(H,20,23)(H,21,22,25) |
| InChIKey | JLAZSGGFWWOHNJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|