C18H18F2N4O3S — CID 73338936
N-[4-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxopiperidine-3-carboxamide (PubChem CID 73338936) has the molecular formula C18H18F2N4O3S and a molecular weight of 408.43 g/mol. Its IUPAC name is N-[4-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxopiperidine-3-carboxamide.
| Compound Name | N-[4-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 73338936 |
| Molecular Formula | C18H18F2N4O3S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[4-[2-[(2,6-difluorophenyl)methylamino]-2-oxoethyl]-1,3-thiazol-2-yl]-2-oxopiperidine-3-carboxamide |
| SMILES | O=C(Cc1csc(NC(=O)C2CCCNC2=O)n1)NCc1c(F)cccc1F |
| InChI | InChI=1S/C18H18F2N4O3S/c19-13-4-1-5-14(20)12(13)8-22-15(25)7-10-9-28-18(23-10)24-17(27)11-3-2-6-21-16(11)26/h1,4-5,9,11H,2-3,6-8H2,(H,21,26)(H,22,25)(H,23,24,27) |
| InChIKey | KKRWUGLICZVJFT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|