C6H6BrNOS — CID 87995434
2-[4-(bromomethyl)-1,3-thiazol-2-yl]acetaldehyde (PubChem CID 87995434) has the molecular formula C6H6BrNOS and a molecular weight of 220.09 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-1,3-thiazol-2-yl]acetaldehyde.
| Compound Name | 2-[4-(bromomethyl)-1,3-thiazol-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 87995434 |
| Molecular Formula | C6H6BrNOS |
| Molecular Weight | 220.09 g/mol |
| Exact Mass | 218.94 |
| IUPAC Name | 2-[4-(bromomethyl)-1,3-thiazol-2-yl]acetaldehyde |
| SMILES | O=CCc1nc(CBr)cs1 |
| InChI | InChI=1S/C6H6BrNOS/c7-3-5-4-10-6(8-5)1-2-9/h2,4H,1,3H2 |
| InChIKey | YZZBLWMQRBTIFX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.09 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|