C8H6BrNS2 — CID 81222713
4-(bromomethyl)-2-thiophen-3-yl-1,3-thiazole (PubChem CID 81222713) has the molecular formula C8H6BrNS2 and a molecular weight of 260.18 g/mol. Its IUPAC name is 4-(bromomethyl)-2-thiophen-3-yl-1,3-thiazole.
| Compound Name | 4-(bromomethyl)-2-thiophen-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 81222713 |
| Molecular Formula | C8H6BrNS2 |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 258.91 |
| IUPAC Name | 4-(bromomethyl)-2-thiophen-3-yl-1,3-thiazole |
| SMILES | BrCc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C8H6BrNS2/c9-3-7-5-12-8(10-7)6-1-2-11-4-6/h1-2,4-5H,3H2 |
| InChIKey | PAFLHZODZZMSFR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|