C11H9BrN4S2 — CID 55071920
4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole (PubChem CID 55071920) has the molecular formula C11H9BrN4S2 and a molecular weight of 341.26 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole.
| Compound Name | 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 55071920 |
| Molecular Formula | C11H9BrN4S2 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 339.95 |
| IUPAC Name | 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-thiophen-3-yl-1,3-thiazole |
| SMILES | BrCc1cn(Cc2csc(-c3ccsc3)n2)nn1 |
| InChI | InChI=1S/C11H9BrN4S2/c12-3-9-4-16(15-14-9)5-10-7-18-11(13-10)8-1-2-17-6-8/h1-2,4,6-7H,3,5H2 |
| InChIKey | ZTXJCENTKSHSEO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|