C14H17N3S2 — CID 60916712
4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-2-thiophen-3-yl-1,3-thiazole (PubChem CID 60916712) has the molecular formula C14H17N3S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-2-thiophen-3-yl-1,3-thiazole.
| Compound Name | 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-2-thiophen-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 60916712 |
| Molecular Formula | C14H17N3S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-ylmethyl)-2-thiophen-3-yl-1,3-thiazole |
| SMILES | c1cc(-c2nc(CN3CC4CNCC4C3)cs2)cs1 |
| InChI | InChI=1S/C14H17N3S2/c1-2-18-8-10(1)14-16-13(9-19-14)7-17-5-11-3-15-4-12(11)6-17/h1-2,8-9,11-12,15H,3-7H2 |
| InChIKey | SEELADWRGLPCDE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |