C12H14N2OS2 — CID 55130969
1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]pyrrolidin-3-ol (PubChem CID 55130969) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]pyrrolidin-3-ol.
| Compound Name | 1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 55130969 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]pyrrolidin-3-ol |
| SMILES | OC1CCN(Cc2csc(-c3ccsc3)n2)C1 |
| InChI | InChI=1S/C12H14N2OS2/c15-11-1-3-14(6-11)5-10-8-17-12(13-10)9-2-4-16-7-9/h2,4,7-8,11,15H,1,3,5-6H2 |
| InChIKey | AQBVRTAWRYGLAK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |