C16H20N2OS — CID 103898315
4-methyl-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidin-3-ol (PubChem CID 103898315) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-methyl-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidin-3-ol.
| Compound Name | 4-methyl-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidin-3-ol |
|---|---|
| PubChem CID | 103898315 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 4-methyl-1-[(2-phenyl-1,3-thiazol-4-yl)methyl]piperidin-3-ol |
| SMILES | CC1CCN(Cc2csc(-c3ccccc3)n2)CC1O |
| InChI | InChI=1S/C16H20N2OS/c1-12-7-8-18(10-15(12)19)9-14-11-20-16(17-14)13-5-3-2-4-6-13/h2-6,11-12,15,19H,7-10H2,1H3 |
| InChIKey | VHTOOYKETJYNNZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |