C15H17BrN2OS — CID 33186793
1-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methyl]piperidin-4-ol (PubChem CID 33186793) has the molecular formula C15H17BrN2OS and a molecular weight of 353.29 g/mol. Its IUPAC name is 1-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methyl]piperidin-4-ol.
| Compound Name | 1-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 33186793 |
| Molecular Formula | C15H17BrN2OS |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 1-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methyl]piperidin-4-ol |
| SMILES | OC1CCN(Cc2csc(-c3cccc(Br)c3)n2)CC1 |
| InChI | InChI=1S/C15H17BrN2OS/c16-12-3-1-2-11(8-12)15-17-13(10-20-15)9-18-6-4-14(19)5-7-18/h1-3,8,10,14,19H,4-7,9H2 |
| InChIKey | GNLQKUKQSIFPBV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |