C11H10BrNS2 — CID 116889576
2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]ethanethiol (PubChem CID 116889576) has the molecular formula C11H10BrNS2 and a molecular weight of 300.25 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]ethanethiol.
| Compound Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]ethanethiol |
|---|---|
| PubChem CID | 116889576 |
| Molecular Formula | C11H10BrNS2 |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 298.94 |
| IUPAC Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]ethanethiol |
| SMILES | SCCc1csc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C11H10BrNS2/c12-9-3-1-2-8(6-9)11-13-10(4-5-14)7-15-11/h1-3,6-7,14H,4-5H2 |
| InChIKey | YJZRBIPXIAYKEM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|