C14H15NS2 — CID 116889549
2-[2-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-4-yl]ethanethiol (PubChem CID 116889549) has the molecular formula C14H15NS2 and a molecular weight of 261.42 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-4-yl]ethanethiol.
| Compound Name | 2-[2-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-4-yl]ethanethiol |
|---|---|
| PubChem CID | 116889549 |
| Molecular Formula | C14H15NS2 |
| Molecular Weight | 261.42 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-[2-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-4-yl]ethanethiol |
| SMILES | SCCc1csc(-c2ccc3c(c2)CCC3)n1 |
| InChI | InChI=1S/C14H15NS2/c16-7-6-13-9-17-14(15-13)12-5-4-10-2-1-3-11(10)8-12/h4-5,8-9,16H,1-3,6-7H2 |
| InChIKey | RIWIXAKBRJNBPO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|