C13H13NOS — CID 71998381
[4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-yl]methanol (PubChem CID 71998381) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is [4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-yl]methanol.
| Compound Name | [4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 71998381 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | [4-(2,3-dihydro-1H-inden-5-yl)-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1nc(-c2ccc3c(c2)CCC3)cs1 |
| InChI | InChI=1S/C13H13NOS/c15-7-13-14-12(8-16-13)11-5-4-9-2-1-3-10(9)6-11/h4-6,8,15H,1-3,7H2 |
| InChIKey | JVSQBBHTRWFLSM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |