C13H13NO2S — CID 116867444
[4-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-2-yl]methanol (PubChem CID 116867444) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is [4-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-2-yl]methanol.
| Compound Name | [4-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-2-yl]methanol |
|---|---|
| PubChem CID | 116867444 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | [4-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1nc(-c2ccc3c(c2)CCCO3)cs1 |
| InChI | InChI=1S/C13H13NO2S/c15-7-13-14-11(8-17-13)9-3-4-12-10(6-9)2-1-5-16-12/h3-4,6,8,15H,1-2,5,7H2 |
| InChIKey | IWXPASZKNNXEJQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |