C12H11NO2S — CID 116889808
2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-ol (PubChem CID 116889808) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-ol.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 116889808 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-ol |
| SMILES | Oc1csc(-c2ccc3c(c2)CCCO3)n1 |
| InChI | InChI=1S/C12H11NO2S/c14-11-7-16-12(13-11)9-3-4-10-8(6-9)2-1-5-15-10/h3-4,6-7,14H,1-2,5H2 |
| InChIKey | YAKOTFOLIQJYCG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |