C13H13NOS — CID 116891920
2-(3,4-dihydro-2H-chromen-6-yl)-4-methyl-1,3-thiazole (PubChem CID 116891920) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-4-methyl-1,3-thiazole.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-4-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 116891920 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-4-methyl-1,3-thiazole |
| SMILES | Cc1csc(-c2ccc3c(c2)CCCO3)n1 |
| InChI | InChI=1S/C13H13NOS/c1-9-8-16-13(14-9)11-4-5-12-10(7-11)3-2-6-15-12/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | PJMKYPNIKBSSCM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |