2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid

C14H13NO3S — CID 98019181

IUPAC2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(-c2ccc3c(c2)CCCO3)n1
InChIInChI=1S/C14H13NO3S/c16-13(17)7-11-8-19-14(15-11)10-3-4-12-9(6-10)2-1-5-18-12/h3-4,6,8H,1-2,5,7H2,(H,16,17)
InChIKeySFZKBMREUBCDLS-UHFFFAOYSA-N
MW275.33 g/mol
LogP2.76
Rot. Bonds3

About 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid

2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 98019181) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid
PubChem CID98019181
Molecular FormulaC14H13NO3S
Molecular Weight275.33 g/mol
Exact Mass275.06
IUPAC Name2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(-c2ccc3c(c2)CCCO3)n1
InChIInChI=1S/C14H13NO3S/c16-13(17)7-11-8-19-14(15-11)10-3-4-12-9(6-10)2-1-5-18-12/h3-4,6,8H,1-2,5,7H2,(H,16,17)
InChIKeySFZKBMREUBCDLS-UHFFFAOYSA-N
XLogP2.76
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.33
LogP ≤ 52.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid (CID 98019181) is 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(-c2ccc3c(c2)CCCO3)n1.
What is the InChIKey of 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is SFZKBMREUBCDLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3S/c16-13(17)7-11-8-19-14(15-11)10-3-4-12-9(6-10)2-1-5-18-12/h3-4,6,8H,1-2,5,7H2,(H,16,17).
What are the key properties of 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 275.33 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 98019181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).