C14H13NO3S — CID 98019181
2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 98019181) has the molecular formula C14H13NO3S and a molecular weight of 275.33 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 98019181 |
| Molecular Formula | C14H13NO3S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-[2-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(-c2ccc3c(c2)CCCO3)n1 |
| InChI | InChI=1S/C14H13NO3S/c16-13(17)7-11-8-19-14(15-11)10-3-4-12-9(6-10)2-1-5-18-12/h3-4,6,8H,1-2,5,7H2,(H,16,17) |
| InChIKey | SFZKBMREUBCDLS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |