C13H14N2O2 — CID 116831842
4-(3,4-dihydro-2H-chromen-6-yl)-5-methyl-1,3-oxazol-2-amine (PubChem CID 116831842) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-6-yl)-5-methyl-1,3-oxazol-2-amine.
| Compound Name | 4-(3,4-dihydro-2H-chromen-6-yl)-5-methyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 116831842 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-6-yl)-5-methyl-1,3-oxazol-2-amine |
| SMILES | Cc1oc(N)nc1-c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C13H14N2O2/c1-8-12(15-13(14)17-8)10-4-5-11-9(7-10)3-2-6-16-11/h4-5,7H,2-3,6H2,1H3,(H2,14,15) |
| InChIKey | WOGCKOVZCLZBHT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |