C14H15N3O — CID 82477483
[3-(3,4-dihydro-2H-chromen-6-yl)pyrazin-2-yl]methanamine (PubChem CID 82477483) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is [3-(3,4-dihydro-2H-chromen-6-yl)pyrazin-2-yl]methanamine.
| Compound Name | [3-(3,4-dihydro-2H-chromen-6-yl)pyrazin-2-yl]methanamine |
|---|---|
| PubChem CID | 82477483 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | [3-(3,4-dihydro-2H-chromen-6-yl)pyrazin-2-yl]methanamine |
| SMILES | NCc1nccnc1-c1ccc2c(c1)CCCO2 |
| InChI | InChI=1S/C14H15N3O/c15-9-12-14(17-6-5-16-12)11-3-4-13-10(8-11)2-1-7-18-13/h3-6,8H,1-2,7,9,15H2 |
| InChIKey | VKGJIFZDQGYOBF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |