C13H15N3O — CID 82474070
[3-(3,4-dihydro-2H-chromen-6-yl)-1H-pyrazol-5-yl]methanamine (PubChem CID 82474070) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is [3-(3,4-dihydro-2H-chromen-6-yl)-1H-pyrazol-5-yl]methanamine.
| Compound Name | [3-(3,4-dihydro-2H-chromen-6-yl)-1H-pyrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 82474070 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | [3-(3,4-dihydro-2H-chromen-6-yl)-1H-pyrazol-5-yl]methanamine |
| SMILES | NCc1cc(-c2ccc3c(c2)CCCO3)n[nH]1 |
| InChI | InChI=1S/C13H15N3O/c14-8-11-7-12(16-15-11)9-3-4-13-10(6-9)2-1-5-17-13/h3-4,6-7H,1-2,5,8,14H2,(H,15,16) |
| InChIKey | LQQMXUQJJUSHAR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |