C13H13NOS2 — CID 116965909
[4-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-2-yl]methanethiol (PubChem CID 116965909) has the molecular formula C13H13NOS2 and a molecular weight of 263.39 g/mol. Its IUPAC name is [4-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-2-yl]methanethiol.
| Compound Name | [4-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-2-yl]methanethiol |
|---|---|
| PubChem CID | 116965909 |
| Molecular Formula | C13H13NOS2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | [4-(3,4-dihydro-2H-chromen-6-yl)-1,3-thiazol-2-yl]methanethiol |
| SMILES | SCc1nc(-c2ccc3c(c2)CCCO3)cs1 |
| InChI | InChI=1S/C13H13NOS2/c16-7-13-14-11(8-17-13)9-3-4-12-10(6-9)2-1-5-15-12/h3-4,6,8,16H,1-2,5,7H2 |
| InChIKey | OQCGUGWIARDSKB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 22.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|