C16H23N3OS2 — CID 110906485
1-[3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylamino]propyl]piperidin-4-ol (PubChem CID 110906485) has the molecular formula C16H23N3OS2 and a molecular weight of 337.51 g/mol. Its IUPAC name is 1-[3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylamino]propyl]piperidin-4-ol.
| Compound Name | 1-[3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylamino]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 110906485 |
| Molecular Formula | C16H23N3OS2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 1-[3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylamino]propyl]piperidin-4-ol |
| SMILES | OC1CCN(CCCNCc2csc(-c3ccsc3)n2)CC1 |
| InChI | InChI=1S/C16H23N3OS2/c20-15-2-7-19(8-3-15)6-1-5-17-10-14-12-22-16(18-14)13-4-9-21-11-13/h4,9,11-12,15,17,20H,1-3,5-8,10H2 |
| InChIKey | DAIIHTMKOGYSFN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|