C10H13BrN4S — CID 62400670
4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-propyl-1,3-thiazole (PubChem CID 62400670) has the molecular formula C10H13BrN4S and a molecular weight of 301.21 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-propyl-1,3-thiazole.
| Compound Name | 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-propyl-1,3-thiazole |
|---|---|
| PubChem CID | 62400670 |
| Molecular Formula | C10H13BrN4S |
| Molecular Weight | 301.21 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-propyl-1,3-thiazole |
| SMILES | CCCc1nc(Cn2cc(CBr)nn2)cs1 |
| InChI | InChI=1S/C10H13BrN4S/c1-2-3-10-12-9(7-16-10)6-15-5-8(4-11)13-14-15/h5,7H,2-4,6H2,1H3 |
| InChIKey | IFLKDZDUPQOVKL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.21 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|