C12H19N5S — CID 66192578
N-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methyl]propan-1-amine (PubChem CID 66192578) has the molecular formula C12H19N5S and a molecular weight of 265.39 g/mol. Its IUPAC name is N-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66192578 |
| Molecular Formula | C12H19N5S |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-[[1-[(2-ethyl-1,3-thiazol-4-yl)methyl]triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(Cc2csc(CC)n2)nn1 |
| InChI | InChI=1S/C12H19N5S/c1-3-5-13-6-10-7-17(16-15-10)8-11-9-18-12(4-2)14-11/h7,9,13H,3-6,8H2,1-2H3 |
| InChIKey | LGKRRNAPLVAVHY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|