C11H15BrN4S — CID 66194700
N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]propan-1-amine (PubChem CID 66194700) has the molecular formula C11H15BrN4S and a molecular weight of 315.24 g/mol. Its IUPAC name is N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66194700 |
| Molecular Formula | C11H15BrN4S |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-[[1-[(5-bromothiophen-3-yl)methyl]triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(Cc2csc(Br)c2)nn1 |
| InChI | InChI=1S/C11H15BrN4S/c1-2-3-13-5-10-7-16(15-14-10)6-9-4-11(12)17-8-9/h4,7-8,13H,2-3,5-6H2,1H3 |
| InChIKey | XHDMHNDIDAPLPM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|