C11H17BrN6 — CID 62440961
N-[[1-[2-(4-bromopyrazol-1-yl)ethyl]triazol-4-yl]methyl]propan-1-amine (PubChem CID 62440961) has the molecular formula C11H17BrN6 and a molecular weight of 313.20 g/mol. Its IUPAC name is N-[[1-[2-(4-bromopyrazol-1-yl)ethyl]triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[2-(4-bromopyrazol-1-yl)ethyl]triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62440961 |
| Molecular Formula | C11H17BrN6 |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | N-[[1-[2-(4-bromopyrazol-1-yl)ethyl]triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(CCn2cc(Br)cn2)nn1 |
| InChI | InChI=1S/C11H17BrN6/c1-2-3-13-7-11-9-18(16-15-11)5-4-17-8-10(12)6-14-17/h6,8-9,13H,2-5,7H2,1H3 |
| InChIKey | OCFPJEDBVAUILB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|