C15H22N4S — CID 66191990
N-[[1-[2-(4-methylphenyl)sulfanylethyl]triazol-4-yl]methyl]propan-1-amine (PubChem CID 66191990) has the molecular formula C15H22N4S and a molecular weight of 290.44 g/mol. Its IUPAC name is N-[[1-[2-(4-methylphenyl)sulfanylethyl]triazol-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[2-(4-methylphenyl)sulfanylethyl]triazol-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66191990 |
| Molecular Formula | C15H22N4S |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | N-[[1-[2-(4-methylphenyl)sulfanylethyl]triazol-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cn(CCSc2ccc(C)cc2)nn1 |
| InChI | InChI=1S/C15H22N4S/c1-3-8-16-11-14-12-19(18-17-14)9-10-20-15-6-4-13(2)5-7-15/h4-7,12,16H,3,8-11H2,1-2H3 |
| InChIKey | FFBLXGREFLPHOP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|