C13H10BrClN4S — CID 62399905
4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-(2-chlorophenyl)-1,3-thiazole (PubChem CID 62399905) has the molecular formula C13H10BrClN4S and a molecular weight of 369.68 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-(2-chlorophenyl)-1,3-thiazole.
| Compound Name | 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-(2-chlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 62399905 |
| Molecular Formula | C13H10BrClN4S |
| Molecular Weight | 369.68 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 4-[[4-(bromomethyl)triazol-1-yl]methyl]-2-(2-chlorophenyl)-1,3-thiazole |
| SMILES | Clc1ccccc1-c1nc(Cn2cc(CBr)nn2)cs1 |
| InChI | InChI=1S/C13H10BrClN4S/c14-5-9-6-19(18-17-9)7-10-8-20-13(16-10)11-3-1-2-4-12(11)15/h1-4,6,8H,5,7H2 |
| InChIKey | DUHZVIMQSHVAKL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.68 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|