C11H11NO2S3 — CID 43241285
3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid (PubChem CID 43241285) has the molecular formula C11H11NO2S3 and a molecular weight of 285.41 g/mol. Its IUPAC name is 3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid.
| Compound Name | 3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 43241285 |
| Molecular Formula | C11H11NO2S3 |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 3-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid |
| SMILES | O=C(O)CCSCc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C11H11NO2S3/c13-10(14)2-4-16-6-9-7-17-11(12-9)8-1-3-15-5-8/h1,3,5,7H,2,4,6H2,(H,13,14) |
| InChIKey | UEPFRHGOHRSPRN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|