C10H15NO2S2 — CID 61229647
3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid (PubChem CID 61229647) has the molecular formula C10H15NO2S2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid.
| Compound Name | 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 61229647 |
| Molecular Formula | C10H15NO2S2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-[(2-propan-2-yl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid |
| SMILES | CC(C)c1nc(CSCCC(=O)O)cs1 |
| InChI | InChI=1S/C10H15NO2S2/c1-7(2)10-11-8(6-15-10)5-14-4-3-9(12)13/h6-7H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | SLUZMJRJKORLMY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|