About methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate
methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate (PubChem CID 110728086) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate.
Analyze methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate?
The IUPAC name of methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate (CID 110728086) is methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate.
What is the SMILES notation for methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate?
The canonical SMILES for methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate is COC(=O)NCc1csc(C(C)C)n1.
What is the InChIKey of methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate?
The InChIKey is ZKHCVCOLTFPHMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-6(2)8-11-7(5-14-8)4-10-9(12)13-3/h5-6H,4H2,1-3H3,(H,10,12).
What are the key properties of methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate?
methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate has a molecular weight of 214.29 g/mol, XLogP of 2.12, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamate is sourced from PubChem (CID 110728086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).