C8H11NO2S — CID 115087613
2-[2-(3-hydroxypropyl)-1,3-thiazol-4-yl]acetaldehyde (PubChem CID 115087613) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-[2-(3-hydroxypropyl)-1,3-thiazol-4-yl]acetaldehyde.
| Compound Name | 2-[2-(3-hydroxypropyl)-1,3-thiazol-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 115087613 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 2-[2-(3-hydroxypropyl)-1,3-thiazol-4-yl]acetaldehyde |
| SMILES | O=CCc1csc(CCCO)n1 |
| InChI | InChI=1S/C8H11NO2S/c10-4-1-2-8-9-7(3-5-11)6-12-8/h5-6,10H,1-4H2 |
| InChIKey | KRKRWESCMWQKHC-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|