C7H11NOS — CID 55264368
2-(2-ethyl-1,3-thiazol-4-yl)ethanol (PubChem CID 55264368) has the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. Its IUPAC name is 2-(2-ethyl-1,3-thiazol-4-yl)ethanol.
| Compound Name | 2-(2-ethyl-1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 55264368 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 2-(2-ethyl-1,3-thiazol-4-yl)ethanol |
| SMILES | CCc1nc(CCO)cs1 |
| InChI | InChI=1S/C7H11NOS/c1-2-7-8-6(3-4-9)5-10-7/h5,9H,2-4H2,1H3 |
| InChIKey | GUQGCPDUXAZWRF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |