C9H16N2OS — CID 62070996
2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propan-1-ol (PubChem CID 62070996) has the molecular formula C9H16N2OS and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propan-1-ol.
| Compound Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 62070996 |
| Molecular Formula | C9H16N2OS |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propan-1-ol |
| SMILES | CCc1nc(CNC(C)CO)cs1 |
| InChI | InChI=1S/C9H16N2OS/c1-3-9-11-8(6-13-9)4-10-7(2)5-12/h6-7,10,12H,3-5H2,1-2H3 |
| InChIKey | FVHULGMFHJRWMD-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |