About 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol
2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol (PubChem CID 115659723) has the molecular formula C9H15NOS2
and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol.
Molecular Properties
| Compound Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol |
| PubChem CID | 115659723 |
| Molecular Formula | C9H15NOS2 |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.06 |
| IUPAC Name | 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol |
| SMILES | CCc1nc(CSC(C)CO)cs1 |
| InChI | InChI=1S/C9H15NOS2/c1-3-9-10-8(6-13-9)5-12-7(2)4-11/h6-7,11H,3-5H2,1-2H3 |
| InChIKey | SVLAYJMCFABLNB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol?
The IUPAC name of 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol (CID 115659723) is 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol.
What is the SMILES notation for 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol?
The canonical SMILES for 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol is CCc1nc(CSC(C)CO)cs1.
What is the InChIKey of 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol?
The InChIKey is SVLAYJMCFABLNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NOS2/c1-3-9-10-8(6-13-9)5-12-7(2)4-11/h6-7,11H,3-5H2,1-2H3.
What are the key properties of 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol?
2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol has a molecular weight of 217.36 g/mol, XLogP of 2.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethyl-1,3-thiazol-4-yl)methylsulfanyl]propan-1-ol is sourced from PubChem (CID 115659723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).