C7H11N3S2 — CID 65211790
(2-ethyl-1,3-thiazol-4-yl)methyl carbamimidothioate (PubChem CID 65211790) has the molecular formula C7H11N3S2 and a molecular weight of 201.32 g/mol. Its IUPAC name is (2-ethyl-1,3-thiazol-4-yl)methyl carbamimidothioate.
| Compound Name | (2-ethyl-1,3-thiazol-4-yl)methyl carbamimidothioate |
|---|---|
| PubChem CID | 65211790 |
| Molecular Formula | C7H11N3S2 |
| Molecular Weight | 201.32 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | (2-ethyl-1,3-thiazol-4-yl)methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1csc(CC)n1 |
| InChI | InChI=1S/C7H11N3S2/c1-2-6-10-5(3-11-6)4-12-7(8)9/h3H,2,4H2,1H3,(H3,8,9) |
| InChIKey | MFNANMHQOUZKIR-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|