C11H10ClN3S2 — CID 65211721
[2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl carbamimidothioate (PubChem CID 65211721) has the molecular formula C11H10ClN3S2 and a molecular weight of 283.81 g/mol. Its IUPAC name is [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl carbamimidothioate.
| Compound Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 65211721 |
| Molecular Formula | C11H10ClN3S2 |
| Molecular Weight | 283.81 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | [2-(2-chlorophenyl)-1,3-thiazol-4-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C11H10ClN3S2/c12-9-4-2-1-3-8(9)10-15-7(5-16-10)6-17-11(13)14/h1-5H,6H2,(H3,13,14) |
| InChIKey | DSKIROQUKMKWRP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|